C21H37NO4Si — CID 11090552
ethyl (E)-4-oxo-4-[[3-tri(propan-2-yl)silyloxycyclohex-2-en-1-yl]amino]but-2-enoate (PubChem CID 11090552) has the molecular formula C21H37NO4Si and a molecular weight of 395.62 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-[[3-tri(propan-2-yl)silyloxycyclohex-2-en-1-yl]amino]but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-[[3-tri(propan-2-yl)silyloxycyclohex-2-en-1-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 11090552 |
| Molecular Formula | C21H37NO4Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | ethyl (E)-4-oxo-4-[[3-tri(propan-2-yl)silyloxycyclohex-2-en-1-yl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC1C=C(O[Si](C(C)C)(C(C)C)C(C)C)CCC1 |
| InChI | InChI=1S/C21H37NO4Si/c1-8-25-21(24)13-12-20(23)22-18-10-9-11-19(14-18)26-27(15(2)3,16(4)5)17(6)7/h12-18H,8-11H2,1-7H3,(H,22,23)/b13-12+ |
| InChIKey | HKLRAORJJOQQFV-OUKQBFOZSA-N |
| XLogP | 4.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|