C18H25N3OS — CID 110905918
[1-[4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol (PubChem CID 110905918) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is [1-[4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 110905918 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | [1-[4-[[(2-methyl-1,3-thiazol-5-yl)methylamino]methyl]phenyl]piperidin-4-yl]methanol |
| SMILES | Cc1ncc(CNCc2ccc(N3CCC(CO)CC3)cc2)s1 |
| InChI | InChI=1S/C18H25N3OS/c1-14-20-12-18(23-14)11-19-10-15-2-4-17(5-3-15)21-8-6-16(13-22)7-9-21/h2-5,12,16,19,22H,6-11,13H2,1H3 |
| InChIKey | GWACITCVMAUWKG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|