C17H23N3O2 — CID 110906136
2-[3,5-dimethyl-4-[(3-prop-2-enoxyanilino)methyl]pyrazol-1-yl]ethanol (PubChem CID 110906136) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[(3-prop-2-enoxyanilino)methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3,5-dimethyl-4-[(3-prop-2-enoxyanilino)methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 110906136 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[3,5-dimethyl-4-[(3-prop-2-enoxyanilino)methyl]pyrazol-1-yl]ethanol |
| SMILES | C=CCOc1cccc(NCc2c(C)nn(CCO)c2C)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-4-10-22-16-7-5-6-15(11-16)18-12-17-13(2)19-20(8-9-21)14(17)3/h4-7,11,18,21H,1,8-10,12H2,2-3H3 |
| InChIKey | LDSPFMDATYOFRJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|