C16H22ClN3O — CID 110906395
3-[(5-chloro-1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-1-ol (PubChem CID 110906395) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 3-[(5-chloro-1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(5-chloro-1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 110906395 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[(5-chloro-1-phenyl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-1-ol |
| SMILES | CC(C)c1nn(-c2ccccc2)c(Cl)c1CNCCCO |
| InChI | InChI=1S/C16H22ClN3O/c1-12(2)15-14(11-18-9-6-10-21)16(17)20(19-15)13-7-4-3-5-8-13/h3-5,7-8,12,18,21H,6,9-11H2,1-2H3 |
| InChIKey | DGIUCFIGVQYOQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|