C23H30O4S — CID 11090710
methyl (2S)-2-[(2R,4aR,5R,7R)-7-formyloxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate (PubChem CID 11090710) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,4aR,5R,7R)-7-formyloxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2R,4aR,5R,7R)-7-formyloxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 11090710 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | methyl (2S)-2-[(2R,4aR,5R,7R)-7-formyloxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@]2(C)C(=C(C)[C@H](OC=O)C[C@H]2Sc2ccccc2)C1 |
| InChI | InChI=1S/C23H30O4S/c1-15(22(25)26-4)17-10-11-23(3)19(12-17)16(2)20(27-14-24)13-21(23)28-18-8-6-5-7-9-18/h5-9,14-15,17,20-21H,10-13H2,1-4H3/t15-,17+,20+,21+,23+/m0/s1 |
| InChIKey | QDTFADAWSNMMCB-JBWWXIPTSA-N |
| XLogP | 5.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|