C18H20N4O5S — CID 11090750
5-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]-N,N-dimethylimidazole-1-sulfonamide (PubChem CID 11090750) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 5-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]-N,N-dimethylimidazole-1-sulfonamide.
| Compound Name | 5-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]-N,N-dimethylimidazole-1-sulfonamide |
|---|---|
| PubChem CID | 11090750 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 5-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]-N,N-dimethylimidazole-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)n1cncc1[C@H]1CC[C@@H](CN2C(=O)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C18H20N4O5S/c1-20(2)28(25,26)22-11-19-9-15(22)16-8-7-12(27-16)10-21-17(23)13-5-3-4-6-14(13)18(21)24/h3-6,9,11-12,16H,7-8,10H2,1-2H3/t12-,16+/m0/s1 |
| InChIKey | WNIRDTBUPJLHMV-BLLLJJGKSA-N |
| XLogP | 1.05 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|