C23H32O6 — CID 11090756
(1'S,2'R,7'S,10'S,11'R,12'S)-7'-methyl-11'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-15-oxatetracyclo[10.2.1.01,10.02,7]pentadec-13-ene]-9'-one (PubChem CID 11090756) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (1'S,2'R,7'S,10'S,11'R,12'S)-7'-methyl-11'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-15-oxatetracyclo[10.2.1.01,10.02,7]pentadec-13-ene]-9'-one.
| Compound Name | (1'S,2'R,7'S,10'S,11'R,12'S)-7'-methyl-11'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-15-oxatetracyclo[10.2.1.01,10.02,7]pentadec-13-ene]-9'-one |
|---|---|
| PubChem CID | 11090756 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1'S,2'R,7'S,10'S,11'R,12'S)-7'-methyl-11'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-15-oxatetracyclo[10.2.1.01,10.02,7]pentadec-13-ene]-9'-one |
| SMILES | CC1(CC[C@H]2[C@@H]3C=C[C@@]4(O3)[C@H]2C(=O)C[C@@]2(C)[C@H]4CCCC23OCCO3)OCCO1 |
| InChI | InChI=1S/C23H32O6/c1-20-14-16(24)19-15(5-8-21(2)25-10-11-26-21)17-6-9-22(19,29-17)18(20)4-3-7-23(20)27-12-13-28-23/h6,9,15,17-19H,3-5,7-8,10-14H2,1-2H3/t15-,17-,18+,19+,20-,22-/m0/s1 |
| InChIKey | ZBSPZUZNZAMZHK-HJZDXVJWSA-N |
| XLogP | 2.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|