C19H25N3O3 — CID 110907856
[2-(2-hydroxyethyl)piperidin-1-yl]-[1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]methanone (PubChem CID 110907856) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)piperidin-1-yl]-[1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]methanone.
| Compound Name | [2-(2-hydroxyethyl)piperidin-1-yl]-[1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 110907856 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | [2-(2-hydroxyethyl)piperidin-1-yl]-[1-(2-methoxy-5-methylphenyl)pyrazol-3-yl]methanone |
| SMILES | COc1ccc(C)cc1-n1ccc(C(=O)N2CCCCC2CCO)n1 |
| InChI | InChI=1S/C19H25N3O3/c1-14-6-7-18(25-2)17(13-14)22-11-8-16(20-22)19(24)21-10-4-3-5-15(21)9-12-23/h6-8,11,13,15,23H,3-5,9-10,12H2,1-2H3 |
| InChIKey | DVFJPEJWQLZHQX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |