C23H44O2Si2 — CID 11090852
[(4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11090852) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is [(4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11090852 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2CCCC[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C23H44O2Si2/c1-22(2,3)26(7,8)24-20-16-13-17-21(19-15-12-11-14-18(19)20)25-27(9,10)23(4,5)6/h13,16,18,20H,11-12,14-15,17H2,1-10H3/t18-,20-/m0/s1 |
| InChIKey | LKAAGRXDAKGYJK-ICSRJNTNSA-N |
| XLogP | 7.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|