About CID 11090857
CID 11090857 (PubChem CID 11090857) has the molecular formula C16H18NO2S
and a molecular weight of 288.39 g/mol.
Molecular Properties
| Compound Name | CID 11090857 |
| PubChem CID | 11090857 |
| Molecular Formula | C16H18NO2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | — |
| SMILES | CC(C)(CO)NC(=O)[C]1[CH][CH][CH][C]1Sc1ccccc1 |
| InChI | InChI=1S/C16H18NO2S/c1-16(2,11-18)17-15(19)13-9-6-10-14(13)20-12-7-4-3-5-8-12/h3-10,18H,11H2,1-2H3,(H,17,19) |
| InChIKey | FAXZMXPCQHEIDJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 11090857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11090857?
The IUPAC name of CID 11090857 (CID 11090857) is not available.
What is the SMILES notation for CID 11090857?
The canonical SMILES for CID 11090857 is CC(C)(CO)NC(=O)[C]1[CH][CH][CH][C]1Sc1ccccc1.
What is the InChIKey of CID 11090857?
The InChIKey is FAXZMXPCQHEIDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18NO2S/c1-16(2,11-18)17-15(19)13-9-6-10-14(13)20-12-7-4-3-5-8-12/h3-10,18H,11H2,1-2H3,(H,17,19).
What are the key properties of CID 11090857?
CID 11090857 has a molecular weight of 288.39 g/mol, XLogP of 2.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11090857 is sourced from PubChem (CID 11090857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).