C24H34O2Si2 — CID 11090894
(3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol (PubChem CID 11090894) has the molecular formula C24H34O2Si2 and a molecular weight of 410.71 g/mol. Its IUPAC name is (3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol.
| Compound Name | (3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 11090894 |
| Molecular Formula | C24H34O2Si2 |
| Molecular Weight | 410.71 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol |
| SMILES | CC(C)(C)[Si](OCC[C@H](O)C#C[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H34O2Si2/c1-24(2,3)28(22-13-9-7-10-14-22,23-15-11-8-12-16-23)26-19-17-21(25)18-20-27(4,5)6/h7-16,21,25H,17,19H2,1-6H3/t21-/m0/s1 |
| InChIKey | LSJRBCWMASQLLS-NRFANRHFSA-N |
| XLogP | 4.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.71 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|