About N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide
N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide (PubChem CID 11090905) has the molecular formula C23H29N3O4
and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide |
| PubChem CID | 11090905 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C23H29N3O4/c27-21(15-9-1-2-10-16-22(28)26-30)25-20(17-18-11-5-3-6-12-18)23(29)24-19-13-7-4-8-14-19/h3-8,11-14,20,30H,1-2,9-10,15-17H2,(H,24,29)(H,25,27)(H,26,28)/t20-/m0/s1 |
| InChIKey | MYDIZQGFKIWIFT-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide?
The IUPAC name of N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide (CID 11090905) is N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide.
What is the SMILES notation for N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide?
The canonical SMILES for N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide is O=C(CCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1)NO.
What is the InChIKey of N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide?
The InChIKey is MYDIZQGFKIWIFT-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H29N3O4/c27-21(15-9-1-2-10-16-22(28)26-30)25-20(17-18-11-5-3-6-12-18)23(29)24-19-13-7-4-8-14-19/h3-8,11-14,20,30H,1-2,9-10,15-17H2,(H,24,29)(H,25,27)(H,26,28)/t20-/m0/s1.
What are the key properties of N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide?
N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide has a molecular weight of 411.50 g/mol, XLogP of 3.20, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide is sourced from PubChem (CID 11090905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).