About 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea
1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea (PubChem CID 110911386) has the molecular formula C18H20F2N2O2
and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea.
Molecular Properties
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea |
| PubChem CID | 110911386 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea |
| SMILES | O=C(NCCc1cc(F)cc(F)c1)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C18H20F2N2O2/c19-15-8-14(9-16(20)11-15)6-7-21-18(24)22-17(12-23)10-13-4-2-1-3-5-13/h1-5,8-9,11,17,23H,6-7,10,12H2,(H2,21,22,24) |
| InChIKey | HFZBFQPMXHQWKU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea?
The IUPAC name of 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea (CID 110911386) is 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea.
What is the SMILES notation for 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea?
The canonical SMILES for 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea is O=C(NCCc1cc(F)cc(F)c1)NC(CO)Cc1ccccc1.
What is the InChIKey of 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea?
The InChIKey is HFZBFQPMXHQWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F2N2O2/c19-15-8-14(9-16(20)11-15)6-7-21-18(24)22-17(12-23)10-13-4-2-1-3-5-13/h1-5,8-9,11,17,23H,6-7,10,12H2,(H2,21,22,24).
What are the key properties of 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea?
1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea has a molecular weight of 334.37 g/mol, XLogP of 2.41, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,5-difluorophenyl)ethyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea is sourced from PubChem (CID 110911386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).