C16H20FNO3 — CID 110912797
(Z)-3-cyclopropyl-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]but-2-enamide (PubChem CID 110912797) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]but-2-enamide.
| Compound Name | (Z)-3-cyclopropyl-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]but-2-enamide |
|---|---|
| PubChem CID | 110912797 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (Z)-3-cyclopropyl-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)NCC(O)COc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C16H20FNO3/c1-11(12-2-3-12)8-16(20)18-9-14(19)10-21-15-6-4-13(17)5-7-15/h4-8,12,14,19H,2-3,9-10H2,1H3,(H,18,20)/b11-8- |
| InChIKey | CXBWWPWWIDENMH-FLIBITNWSA-N |
| XLogP | 2.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|