C25H26N2O5 — CID 11091364
4-[4-(3,4-diethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid (PubChem CID 11091364) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-[4-(3,4-diethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid.
| Compound Name | 4-[4-(3,4-diethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11091364 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[4-(3,4-diethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid |
| SMILES | CCOc1ccc(C2=NN(c3ccc(C(=O)O)cc3)C(=O)C3CC=CCC23)cc1OCC |
| InChI | InChI=1S/C25H26N2O5/c1-3-31-21-14-11-17(15-22(21)32-4-2)23-19-7-5-6-8-20(19)24(28)27(26-23)18-12-9-16(10-13-18)25(29)30/h5-6,9-15,19-20H,3-4,7-8H2,1-2H3,(H,29,30) |
| InChIKey | OZUNUTXZGBJXGF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|