About ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide
ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 110913733) has the molecular formula C12H23IN4O2
and a molecular weight of 382.25 g/mol. Its IUPAC name is ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide.
Molecular Properties
| Compound Name | ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide |
| PubChem CID | 110913733 |
| Molecular Formula | C12H23IN4O2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | C=CC/N=C(\N)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C12H22N4O2.HI/c1-3-7-14-11(13)15-10-5-8-16(9-6-10)12(17)18-4-2;/h3,10H,1,4-9H2,2H3,(H3,13,14,15);1H |
| InChIKey | SGTXDPGXARXZAQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide?
The IUPAC name of ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide (CID 110913733) is ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide.
What is the SMILES notation for ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide?
The canonical SMILES for ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide is C=CC/N=C(\N)NC1CCN(C(=O)OCC)CC1.I.
What is the InChIKey of ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide?
The InChIKey is SGTXDPGXARXZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2.HI/c1-3-7-14-11(13)15-10-5-8-16(9-6-10)12(17)18-4-2;/h3,10H,1,4-9H2,2H3,(H3,13,14,15);1H.
What are the key properties of ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide?
ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide has a molecular weight of 382.25 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(N'-prop-2-enylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide is sourced from PubChem (CID 110913733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).