About (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane
(1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane (PubChem CID 11091390) has the molecular formula C20H22OSe2
and a molecular weight of 436.32 g/mol. Its IUPAC name is (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane |
| PubChem CID | 11091390 |
| Molecular Formula | C20H22OSe2 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane |
| SMILES | c1ccc([Se]C2CC[C@H]3O[C@@H]2CCC3[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22OSe2/c1-3-7-15(8-4-1)22-19-13-11-18-20(14-12-17(19)21-18)23-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-,19?,20?/m1/s1 |
| InChIKey | CHVFRBCTWMFSIX-UVHRUJRTSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane?
The IUPAC name of (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane (CID 11091390) is (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane.
What is the SMILES notation for (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane?
The canonical SMILES for (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane is c1ccc([Se]C2CC[C@H]3O[C@@H]2CCC3[Se]c2ccccc2)cc1.
What is the InChIKey of (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane?
The InChIKey is CHVFRBCTWMFSIX-UVHRUJRTSA-N. The full InChI is InChI=1S/C20H22OSe2/c1-3-7-15(8-4-1)22-19-13-11-18-20(14-12-17(19)21-18)23-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-,19?,20?/m1/s1.
What are the key properties of (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane?
(1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane has a molecular weight of 436.32 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-2,6-bis(phenylselanyl)-9-oxabicyclo[3.3.1]nonane is sourced from PubChem (CID 11091390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).