C10H19N5 — CID 110914283
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine (PubChem CID 110914283) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110914283 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C10H19N5/c1-8-7-9(2)15(14-8)6-4-5-13-10(11)12-3/h7H,4-6H2,1-3H3,(H3,11,12,13) |
| InChIKey | CORDZEOJWYIGLU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|