C24H40O7 — CID 11091467
2-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-2-(1-ethoxyethoxy)-2,5,5,8a-tetramethyl-4-oxo-1,3,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate (PubChem CID 11091467) has the molecular formula C24H40O7 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-2-(1-ethoxyethoxy)-2,5,5,8a-tetramethyl-4-oxo-1,3,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate.
| Compound Name | 2-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-2-(1-ethoxyethoxy)-2,5,5,8a-tetramethyl-4-oxo-1,3,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 11091467 |
| Molecular Formula | C24H40O7 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-2-(1-ethoxyethoxy)-2,5,5,8a-tetramethyl-4-oxo-1,3,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl acetate |
| SMILES | CCOC(C)O[C@]1(C)[C@H](OC(C)=O)C(=O)[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CCOC(C)=O |
| InChI | InChI=1S/C24H40O7/c1-9-28-17(4)31-24(8)18(11-14-29-15(2)25)23(7)13-10-12-22(5,6)20(23)19(27)21(24)30-16(3)26/h17-18,20-21H,9-14H2,1-8H3/t17?,18-,20+,21-,23-,24+/m1/s1 |
| InChIKey | YEQCHDCPCLWGGS-XZXHQMDOSA-N |
| XLogP | 4.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|