C8H17F3IN3O — CID 110914979
1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 110914979) has the molecular formula C8H17F3IN3O and a molecular weight of 355.14 g/mol. Its IUPAC name is 1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110914979 |
| Molecular Formula | C8H17F3IN3O |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C8H16F3N3O.HI/c1-12-7(13-2)14-4-3-5-15-6-8(9,10)11;/h3-6H2,1-2H3,(H2,12,13,14);1H |
| InChIKey | HBMQXKLXZWVFGC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|