C10H16IN3S — CID 110916021
N-[(5-methylthiophen-2-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110916021) has the molecular formula C10H16IN3S and a molecular weight of 337.23 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110916021 |
| Molecular Formula | C10H16IN3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Cc1ccc(CNC2=NCCCN2)s1.I |
| InChI | InChI=1S/C10H15N3S.HI/c1-8-3-4-9(14-8)7-13-10-11-5-2-6-12-10;/h3-4H,2,5-7H2,1H3,(H2,11,12,13);1H |
| InChIKey | QMAAPJBTEILPFM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|