C20H30N4O3 — CID 110918026
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine (PubChem CID 110918026) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110918026 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C20H30N4O3/c1-5-26-12-6-11-21-20(23-14-19-24-15(2)16(3)27-19)22-13-17-7-9-18(25-4)10-8-17/h7-10H,5-6,11-14H2,1-4H3,(H2,21,22,23) |
| InChIKey | RDPACTWVDRNYEA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|