C17H22F3N5O — CID 110918503
2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine (PubChem CID 110918503) has the molecular formula C17H22F3N5O and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine.
| Compound Name | 2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 110918503 |
| Molecular Formula | C17H22F3N5O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine |
| SMILES | COCCN/C(N)=N/Cc1ccc(-n2nc(C)cc2C)cc1C(F)(F)F |
| InChI | InChI=1S/C17H22F3N5O/c1-11-8-12(2)25(24-11)14-5-4-13(15(9-14)17(18,19)20)10-23-16(21)22-6-7-26-3/h4-5,8-9H,6-7,10H2,1-3H3,(H3,21,22,23) |
| InChIKey | KVSKMWVOYNAJBW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|