C13H20FIN4O — CID 110919317
2-[[amino-(butan-2-ylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 110919317) has the molecular formula C13H20FIN4O and a molecular weight of 394.23 g/mol. Its IUPAC name is 2-[[amino-(butan-2-ylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(butan-2-ylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110919317 |
| Molecular Formula | C13H20FIN4O |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[[amino-(butan-2-ylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/CC(=O)Nc1ccc(F)cc1.I |
| InChI | InChI=1S/C13H19FN4O.HI/c1-3-9(2)17-13(15)16-8-12(19)18-11-6-4-10(14)5-7-11;/h4-7,9H,3,8H2,1-2H3,(H,18,19)(H3,15,16,17);1H |
| InChIKey | XXEXWGWJYPDUNJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|