C14H24N4 — CID 110919596
1-[2-(N-ethyl-3-methylanilino)ethyl]-2,3-dimethylguanidine (PubChem CID 110919596) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[2-(N-ethyl-3-methylanilino)ethyl]-2,3-dimethylguanidine.
| Compound Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 110919596 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-2,3-dimethylguanidine |
| SMILES | CCN(CCN/C(=N/C)NC)c1cccc(C)c1 |
| InChI | InChI=1S/C14H24N4/c1-5-18(10-9-17-14(15-3)16-4)13-8-6-7-12(2)11-13/h6-8,11H,5,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | JTRCIKRJMDQCKJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|