About 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide
1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide (PubChem CID 110919953) has the molecular formula C12H29IN4
and a molecular weight of 356.30 g/mol. Its IUPAC name is 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide |
| PubChem CID | 110919953 |
| Molecular Formula | C12H29IN4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/CC(C)N(CC)CC.I |
| InChI | InChI=1S/C12H28N4.HI/c1-6-10(4)15-12(13)14-9-11(5)16(7-2)8-3;/h10-11H,6-9H2,1-5H3,(H3,13,14,15);1H |
| InChIKey | XCPMNDSMQNAUQJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide?
The IUPAC name of 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide (CID 110919953) is 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide.
What is the SMILES notation for 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide?
The canonical SMILES for 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide is CCC(C)N/C(N)=N/CC(C)N(CC)CC.I.
What is the InChIKey of 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide?
The InChIKey is XCPMNDSMQNAUQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N4.HI/c1-6-10(4)15-12(13)14-9-11(5)16(7-2)8-3;/h10-11H,6-9H2,1-5H3,(H3,13,14,15);1H.
What are the key properties of 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide?
1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide has a molecular weight of 356.30 g/mol, XLogP of 2.04, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2-[2-(diethylamino)propyl]guanidine;hydroiodide is sourced from PubChem (CID 110919953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).