C31H37N3O2 — CID 11092088
N-benzyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide (PubChem CID 11092088) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-benzyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide.
| Compound Name | N-benzyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 11092088 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-benzyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-methylbenzamide |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)c2cccc(C(=O)N(C)Cc3ccccc3)c2)C[C@H]1C |
| InChI | InChI=1S/C31H37N3O2/c1-5-17-33-20-24(3)34(21-23(33)2)30(27-14-10-16-29(35)19-27)26-13-9-15-28(18-26)31(36)32(4)22-25-11-7-6-8-12-25/h5-16,18-19,23-24,30,35H,1,17,20-22H2,2-4H3/t23-,24+,30-/m1/s1 |
| InChIKey | APSQTBDUIGGKRT-FSGGQHMVSA-N |
| XLogP | 5.33 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|