C17H23ClN2O3 — CID 110922757
N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-hydroxycyclopentane-1-carboxamide (PubChem CID 110922757) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110922757 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-hydroxycyclopentane-1-carboxamide |
| SMILES | COc1ccc(Cl)cc1N1CCC(NC(=O)C2(O)CCCC2)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-23-15-5-4-12(18)10-14(15)20-9-6-13(11-20)19-16(21)17(22)7-2-3-8-17/h4-5,10,13,22H,2-3,6-9,11H2,1H3,(H,19,21) |
| InChIKey | HPNKCZZRKGPOPM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |