C14H17N3O3 — CID 110923504
1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-1-phenylethyl)urea (PubChem CID 110923504) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-1-phenylethyl)urea.
| Compound Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-1-phenylethyl)urea |
|---|---|
| PubChem CID | 110923504 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-1-phenylethyl)urea |
| SMILES | Cc1nc(NC(=O)NC(CO)c2ccccc2)oc1C |
| InChI | InChI=1S/C14H17N3O3/c1-9-10(2)20-14(15-9)17-13(19)16-12(8-18)11-6-4-3-5-7-11/h3-7,12,18H,8H2,1-2H3,(H2,15,16,17,19) |
| InChIKey | ZRVMEARFDNWAGC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |