C24H48O3Sn — CID 11092355
(2S,3R,4S,5R,6R)-2-methoxy-2,3,5-trimethyl-6-[(E)-3-tributylstannylprop-2-enyl]oxan-4-ol (PubChem CID 11092355) has the molecular formula C24H48O3Sn and a molecular weight of 503.36 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-methoxy-2,3,5-trimethyl-6-[(E)-3-tributylstannylprop-2-enyl]oxan-4-ol.
| Compound Name | (2S,3R,4S,5R,6R)-2-methoxy-2,3,5-trimethyl-6-[(E)-3-tributylstannylprop-2-enyl]oxan-4-ol |
|---|---|
| PubChem CID | 11092355 |
| Molecular Formula | C24H48O3Sn |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-methoxy-2,3,5-trimethyl-6-[(E)-3-tributylstannylprop-2-enyl]oxan-4-ol |
| SMILES | CCCC[Sn](/C=C/C[C@H]1O[C@](C)(OC)[C@H](C)[C@@H](O)[C@H]1C)(CCCC)CCCC |
| InChI | InChI=1S/C12H21O3.3C4H9.Sn/c1-6-7-10-8(2)11(13)9(3)12(4,14-5)15-10;3*1-3-4-2;/h1,6,8-11,13H,7H2,2-5H3;3*1,3-4H2,2H3;/t8-,9+,10+,11-,12-;;;;/m0..../s1 |
| InChIKey | MTYMFHSUFFEZLT-ZJVVFBAISA-N |
| XLogP | 6.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |