C25H31NO10 — CID 11092378
triethyl [(3R,6S,7R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methanetricarboxylate (PubChem CID 11092378) has the molecular formula C25H31NO10 and a molecular weight of 505.52 g/mol. Its IUPAC name is triethyl [(3R,6S,7R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methanetricarboxylate.
| Compound Name | triethyl [(3R,6S,7R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methanetricarboxylate |
|---|---|
| PubChem CID | 11092378 |
| Molecular Formula | C25H31NO10 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | triethyl [(3R,6S,7R,7aS)-6-ethoxycarbonyl-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methanetricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N2[C@@H](c3ccccc3)OC[C@@H]2[C@H]1C(C(=O)OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H31NO10/c1-5-32-21(28)17-18(16-14-36-20(26(16)19(17)27)15-12-10-9-11-13-15)25(22(29)33-6-2,23(30)34-7-3)24(31)35-8-4/h9-13,16-18,20H,5-8,14H2,1-4H3/t16-,17+,18-,20-/m1/s1 |
| InChIKey | CSCYIBBNCKEYIL-AJYBTWMASA-N |
| XLogP | 1.40 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|