About 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol
5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol (PubChem CID 110923925) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol |
| PubChem CID | 110923925 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol |
| SMILES | OCCCCCN1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C19H23NO/c21-13-7-1-6-12-20-14-16-8-2-4-10-18(16)19-11-5-3-9-17(19)15-20/h2-5,8-11,21H,1,6-7,12-15H2 |
| InChIKey | RISGPETXTSPVAS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol?
The IUPAC name of 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol (CID 110923925) is 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol.
What is the SMILES notation for 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol?
The canonical SMILES for 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol is OCCCCCN1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol?
The InChIKey is RISGPETXTSPVAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO/c21-13-7-1-6-12-20-14-16-8-2-4-10-18(16)19-11-5-3-9-17(19)15-20/h2-5,8-11,21H,1,6-7,12-15H2.
What are the key properties of 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol?
5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol has a molecular weight of 281.40 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)pentan-1-ol is sourced from PubChem (CID 110923925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).