C21H31N4O7SSi+ — CID 11092438
(E)-3-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfinyl-1-hydroxy-1-[(4-nitrophenyl)methoxy]prop-1-ene-2-diazonium (PubChem CID 11092438) has the molecular formula C21H31N4O7SSi+ and a molecular weight of 511.65 g/mol. Its IUPAC name is (E)-3-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfinyl-1-hydroxy-1-[(4-nitrophenyl)methoxy]prop-1-ene-2-diazonium.
| Compound Name | (E)-3-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfinyl-1-hydroxy-1-[(4-nitrophenyl)methoxy]prop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11092438 |
| Molecular Formula | C21H31N4O7SSi+ |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (E)-3-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfinyl-1-hydroxy-1-[(4-nitrophenyl)methoxy]prop-1-ene-2-diazonium |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1S(=O)C/C([N+]#N)=C(/O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H30N4O7SSi/c1-13(32-34(5,6)21(2,3)4)17-18(26)23-19(17)33(30)12-16(24-22)20(27)31-11-14-7-9-15(10-8-14)25(28)29/h7-10,13,17,19H,11-12H2,1-6H3,(H-,23,26,27)/p+1/b20-16+/t13-,17+,19-,33?/m1/s1 |
| InChIKey | SWVXHTGKOOKPIA-HINOGQKSSA-O |
| XLogP | 3.92 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|