C21H21N3 — CID 110924821
2-(2,2-diphenylethyl)-1-phenylguanidine (PubChem CID 110924821) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(2,2-diphenylethyl)-1-phenylguanidine.
| Compound Name | 2-(2,2-diphenylethyl)-1-phenylguanidine |
|---|---|
| PubChem CID | 110924821 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-(2,2-diphenylethyl)-1-phenylguanidine |
| SMILES | N/C(=N\CC(c1ccccc1)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H21N3/c22-21(24-19-14-8-3-9-15-19)23-16-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-15,20H,16H2,(H3,22,23,24) |
| InChIKey | BMDHBICKFUSZAO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|