C26H50O6Si2 — CID 11092490
tert-butyl-[[(2R,3R,6S)-2-[2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane (PubChem CID 11092490) has the molecular formula C26H50O6Si2 and a molecular weight of 514.85 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,6S)-2-[2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R,6S)-2-[2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11092490 |
| Molecular Formula | C26H50O6Si2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | tert-butyl-[[(2R,3R,6S)-2-[2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethyl]-6-methoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane |
| SMILES | CO[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC[C@H]2O[C@H](OC)C=C[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H50O6Si2/c1-25(2,3)33(9,10)31-21-15-17-23(27-7)29-19(21)13-14-20-22(16-18-24(28-8)30-20)32-34(11,12)26(4,5)6/h15-24H,13-14H2,1-12H3/t19-,20+,21-,22+,23+,24- |
| InChIKey | PPINGOFDENTDRZ-BUOQGALMSA-N |
| XLogP | 6.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|