C13H20FN3 — CID 110924914
1,3-diethyl-2-[2-(4-fluorophenyl)ethyl]guanidine (PubChem CID 110924914) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(4-fluorophenyl)ethyl]guanidine.
| Compound Name | 1,3-diethyl-2-[2-(4-fluorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110924914 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 1,3-diethyl-2-[2-(4-fluorophenyl)ethyl]guanidine |
| SMILES | CCNC(=NCCc1ccc(F)cc1)NCC |
| InChI | InChI=1S/C13H20FN3/c1-3-15-13(16-4-2)17-10-9-11-5-7-12(14)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | KDTCXSLUWVAAJU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|