About 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol
2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol (PubChem CID 11092512) has the molecular formula C23H33NO
and a molecular weight of 339.52 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol |
| PubChem CID | 11092512 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol |
| SMILES | Cc1cccc(C)c1NCc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H33NO/c1-15-10-9-11-16(2)20(15)24-14-17-12-18(22(3,4)5)13-19(21(17)25)23(6,7)8/h9-13,24-25H,14H2,1-8H3 |
| InChIKey | GSUHXJKMTXZODI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol?
The IUPAC name of 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol (CID 11092512) is 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol.
What is the SMILES notation for 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol?
The canonical SMILES for 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol is Cc1cccc(C)c1NCc1cc(C(C)(C)C)cc(C(C)(C)C)c1O.
What is the InChIKey of 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol?
The InChIKey is GSUHXJKMTXZODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO/c1-15-10-9-11-16(2)20(15)24-14-17-12-18(22(3,4)5)13-19(21(17)25)23(6,7)8/h9-13,24-25H,14H2,1-8H3.
What are the key properties of 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol?
2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol has a molecular weight of 339.52 g/mol, XLogP of 6.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-6-[(2,6-dimethylanilino)methyl]phenol is sourced from PubChem (CID 11092512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).