C27H25N3O4S2 — CID 11092551
(1R,2R,5S)-2-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]-5-[4-(4-methylsulfanylphenyl)phenyl]sulfanylcyclopentane-1-carboxylic acid (PubChem CID 11092551) has the molecular formula C27H25N3O4S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is (1R,2R,5S)-2-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]-5-[4-(4-methylsulfanylphenyl)phenyl]sulfanylcyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,5S)-2-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]-5-[4-(4-methylsulfanylphenyl)phenyl]sulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 11092551 |
| Molecular Formula | C27H25N3O4S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (1R,2R,5S)-2-[(2,4-dioxopyrido[1,2-a][1,3,5]triazin-3-yl)methyl]-5-[4-(4-methylsulfanylphenyl)phenyl]sulfanylcyclopentane-1-carboxylic acid |
| SMILES | CSc1ccc(-c2ccc(S[C@H]3CC[C@@H](Cn4c(=O)nc5ccccn5c4=O)[C@@H]3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O4S2/c1-35-20-10-5-17(6-11-20)18-7-12-21(13-8-18)36-22-14-9-19(24(22)25(31)32)16-30-26(33)28-23-4-2-3-15-29(23)27(30)34/h2-8,10-13,15,19,22,24H,9,14,16H2,1H3,(H,31,32)/t19-,22-,24-/m0/s1 |
| InChIKey | FWGPCZGIMGDSOM-APTRMMRNSA-N |
| XLogP | 4.52 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |