C17H30IN5 — CID 110925737
2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,3-diethylguanidine;hydroiodide (PubChem CID 110925737) has the molecular formula C17H30IN5 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,3-diethylguanidine;hydroiodide.
| Compound Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,3-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110925737 |
| Molecular Formula | C17H30IN5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1,3-diethylguanidine;hydroiodide |
| SMILES | CCNC(=NCc1ccc(N2CCCCCC2)nc1)NCC.I |
| InChI | InChI=1S/C17H29N5.HI/c1-3-18-17(19-4-2)21-14-15-9-10-16(20-13-15)22-11-7-5-6-8-12-22;/h9-10,13H,3-8,11-12,14H2,1-2H3,(H2,18,19,21);1H |
| InChIKey | AEGBZZUEAMHHKY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|