C22H29FN4O3 — CID 110926175
2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 110926175) has the molecular formula C22H29FN4O3 and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110926175 |
| Molecular Formula | C22H29FN4O3 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H29FN4O3/c1-3-30-13-5-12-24-22(25-15-17-8-10-20(29-2)11-9-17)26-16-21(28)27-19-7-4-6-18(23)14-19/h4,6-11,14H,3,5,12-13,15-16H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | FQHJZPWTNLAUAU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|