C26H48O3Sn — CID 11092631
(7aS)-2,2,4,6,6-pentamethyl-5-[(Z)-2-tributylstannylethenyl]-7,7a-dihydro-1,3-benzodioxol-5-ol (PubChem CID 11092631) has the molecular formula C26H48O3Sn and a molecular weight of 527.38 g/mol. Its IUPAC name is (7aS)-2,2,4,6,6-pentamethyl-5-[(Z)-2-tributylstannylethenyl]-7,7a-dihydro-1,3-benzodioxol-5-ol.
| Compound Name | (7aS)-2,2,4,6,6-pentamethyl-5-[(Z)-2-tributylstannylethenyl]-7,7a-dihydro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 11092631 |
| Molecular Formula | C26H48O3Sn |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (7aS)-2,2,4,6,6-pentamethyl-5-[(Z)-2-tributylstannylethenyl]-7,7a-dihydro-1,3-benzodioxol-5-ol |
| SMILES | CCCC[Sn](/C=C\C1(O)C(C)=C2OC(C)(C)O[C@H]2CC1(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C14H21O3.3C4H9.Sn/c1-7-14(15)9(2)11-10(8-12(14,3)4)16-13(5,6)17-11;3*1-3-4-2;/h1,7,10,15H,8H2,2-6H3;3*1,3-4H2,2H3;/t10-,14?;;;;/m0..../s1 |
| InChIKey | NUROJVLYCNZVBX-KACAGUQQSA-N |
| XLogP | 7.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |