C10H25IN4O — CID 110927292
1-[3-[2-methoxyethyl(methyl)amino]propyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110927292) has the molecular formula C10H25IN4O and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-[3-[2-methoxyethyl(methyl)amino]propyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[3-[2-methoxyethyl(methyl)amino]propyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110927292 |
| Molecular Formula | C10H25IN4O |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[3-[2-methoxyethyl(methyl)amino]propyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCCN(C)CCOC.I |
| InChI | InChI=1S/C10H24N4O.HI/c1-11-10(12-2)13-6-5-7-14(3)8-9-15-4;/h5-9H2,1-4H3,(H2,11,12,13);1H |
| InChIKey | RAOMKUCSMDQSJA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|