C13H18Cl2IN3 — CID 110928130
N-[2-(2,6-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110928130) has the molecular formula C13H18Cl2IN3 and a molecular weight of 414.12 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[2-(2,6-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110928130 |
| Molecular Formula | C13H18Cl2IN3 |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | CC(CNC1=NCCCN1)c1c(Cl)cccc1Cl.I |
| InChI | InChI=1S/C13H17Cl2N3.HI/c1-9(8-18-13-16-6-3-7-17-13)12-10(14)4-2-5-11(12)15;/h2,4-5,9H,3,6-8H2,1H3,(H2,16,17,18);1H |
| InChIKey | UAOFVXQPDXNBBR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|