C14H18F3N3OS — CID 110929312
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(3-methylthiophen-2-yl)methylamino]butan-2-ol (PubChem CID 110929312) has the molecular formula C14H18F3N3OS and a molecular weight of 333.38 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(3-methylthiophen-2-yl)methylamino]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(3-methylthiophen-2-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 110929312 |
| Molecular Formula | C14H18F3N3OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(3-methylthiophen-2-yl)methylamino]butan-2-ol |
| SMILES | Cc1ccsc1CNCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3OS/c1-10-3-8-22-11(10)9-18-5-4-13(21,14(15,16)17)12-19-6-7-20(12)2/h3,6-8,18,21H,4-5,9H2,1-2H3 |
| InChIKey | WFKGNPVGCMHJOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|