C37H40O5 — CID 11092955
(2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane (PubChem CID 11092955) has the molecular formula C37H40O5 and a molecular weight of 564.72 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane.
| Compound Name | (2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane |
|---|---|
| PubChem CID | 11092955 |
| Molecular Formula | C37H40O5 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane |
| SMILES | C=CC[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H40O5/c1-2-15-33-35(39-25-30-18-9-4-10-19-30)37(41-27-32-22-13-6-14-23-32)36(40-26-31-20-11-5-12-21-31)34(42-33)28-38-24-29-16-7-3-8-17-29/h2-14,16-23,33-37H,1,15,24-28H2/t33-,34+,35-,36+,37+/m0/s1 |
| InChIKey | ADTMAXUMXUHSAE-HKPHLGJNSA-N |
| XLogP | 7.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|