C19H23FN2O3 — CID 110929828
1-[2-(2-ethoxyphenyl)ethyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 110929828) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[2-(2-ethoxyphenyl)ethyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[2-(2-ethoxyphenyl)ethyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110929828 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[2-(2-ethoxyphenyl)ethyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | CCOc1ccccc1CCNC(=O)NCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN2O3/c1-2-25-18-6-4-3-5-15(18)11-12-21-19(24)22-13-17(23)14-7-9-16(20)10-8-14/h3-10,17,23H,2,11-13H2,1H3,(H2,21,22,24) |
| InChIKey | FUDQAAXURRODEV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |