C18H20IN3O2 — CID 110930508
2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110930508) has the molecular formula C18H20IN3O2 and a molecular weight of 437.28 g/mol. Its IUPAC name is 2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110930508 |
| Molecular Formula | C18H20IN3O2 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | C#CCOc1cc(C/N=C(\N)Nc2ccccc2)ccc1OC.I |
| InChI | InChI=1S/C18H19N3O2.HI/c1-3-11-23-17-12-14(9-10-16(17)22-2)13-20-18(19)21-15-7-5-4-6-8-15;/h1,4-10,12H,11,13H2,2H3,(H3,19,20,21);1H |
| InChIKey | CQSWJCNBEWNHGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|