C30H50O5SSi2 — CID 11093062
methyl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxy-phenylsulfanyl-trimethylsilylmethyl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 11093062) has the molecular formula C30H50O5SSi2 and a molecular weight of 578.96 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxy-phenylsulfanyl-trimethylsilylmethyl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxy-phenylsulfanyl-trimethylsilylmethyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11093062 |
| Molecular Formula | C30H50O5SSi2 |
| Molecular Weight | 578.96 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxy-phenylsulfanyl-trimethylsilylmethyl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(OC)(Sc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C30H50O5SSi2/c1-29(2,3)38(9,10)35-26-22-25(31)24(20-16-11-12-17-21-27(32)33-4)28(26)30(34-5,37(6,7)8)36-23-18-14-13-15-19-23/h11,13-16,18-19,24,26,28H,12,17,20-22H2,1-10H3/b16-11-/t24-,26+,28+,30?/m0/s1 |
| InChIKey | FFXLLRIVGJGSOC-KUHAOEARSA-N |
| XLogP | 7.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.96 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|