C33H44O7Si — CID 11093081
methyl (1S,2S,5R)-1-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,5-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 11093081) has the molecular formula C33H44O7Si and a molecular weight of 580.79 g/mol. Its IUPAC name is methyl (1S,2S,5R)-1-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,5-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2S,5R)-1-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,5-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11093081 |
| Molecular Formula | C33H44O7Si |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | methyl (1S,2S,5R)-1-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(3-methoxy-3-oxopropyl)-2,5-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)CC[C@@]1(C)C=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)C[C@@]1(OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C33H44O7Si/c1-24-21-33(30(36)38-8,40-25(2)34)32(6,20-19-29(35)37-7)22-26(24)23-39-41(31(3,4)5,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,22,24H,19-21,23H2,1-8H3/t24-,32+,33-/m1/s1 |
| InChIKey | UTDGXZPWEYWBBG-JQTYSHOSSA-N |
| XLogP | 4.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|