C15H22F14O4Si2 — CID 11093133
trimethyl-[2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-trimethylsilyloxypropan-2-yl)oxypropan-2-yl]oxypropoxy]silane (PubChem CID 11093133) has the molecular formula C15H22F14O4Si2 and a molecular weight of 588.48 g/mol. Its IUPAC name is trimethyl-[2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-trimethylsilyloxypropan-2-yl)oxypropan-2-yl]oxypropoxy]silane.
| Compound Name | trimethyl-[2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-trimethylsilyloxypropan-2-yl)oxypropan-2-yl]oxypropoxy]silane |
|---|---|
| PubChem CID | 11093133 |
| Molecular Formula | C15H22F14O4Si2 |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | trimethyl-[2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-trimethylsilyloxypropan-2-yl)oxypropan-2-yl]oxypropoxy]silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(CO[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H22F14O4Si2/c1-34(2,3)30-7-9(16,17)14(26,27)33-11(19,13(23,24)25)15(28,29)32-10(18,12(20,21)22)8-31-35(4,5)6/h7-8H2,1-6H3 |
| InChIKey | NHECNKYKJSJWGU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|